36936-27-3 Usage
Description
2-Amino-5-chloro-4-picoline is an organic compound with the molecular formula C6H6ClN. It is a derivative of picoline, which is a heterocyclic compound with a nitrogen atom in the ring structure. 2-Amino-5-chloro-4-picoline is characterized by the presence of an amino group (-NH2) at the 2nd position, a chlorine atom at the 5th position, and a pyridine ring. It is a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds.
Uses
Used in Research and Development:
2-Amino-5-chloro-4-picoline is used as a research reagent for organic synthesis and other chemical processes. It serves as a key building block in the development of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Amino-5-chloro-4-picoline is used as an intermediate for the synthesis of various drugs and drug candidates. Its unique chemical structure allows for the development of molecules with specific biological activities, making it a valuable tool in the design and synthesis of new therapeutic agents.
Used in Agrochemical Industry:
2-Amino-5-chloro-4-picoline is also utilized in the agrochemical industry for the synthesis of pesticides, herbicides, and other crop protection agents. Its chemical properties enable the creation of molecules with targeted pest control capabilities, contributing to the development of more effective and environmentally friendly agricultural products.
Used in Materials Science:
In the field of materials science, 2-Amino-5-chloro-4-picoline can be employed as a component in the development of advanced materials with specific properties. Its incorporation into polymers, for example, can lead to materials with enhanced mechanical, thermal, or electrical characteristics, depending on the desired application.
Overall, 2-Amino-5-chloro-4-picoline is a versatile compound with a wide range of applications across different industries. Its unique chemical structure and reactivity make it an essential component in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 36936-27-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,9,3 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36936-27:
(7*3)+(6*6)+(5*9)+(4*3)+(3*6)+(2*2)+(1*7)=143
143 % 10 = 3
So 36936-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7ClN2/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3,(H2,8,9)
36936-27-3Relevant articles and documents
Substituted 2-aminopyridines as inhibitors of nitric oxide synthase
-
, (2008/06/13)
Substituted 2-aminopyridine compounds of Formula (I) and pharmaceutically acceptable salts which have been found useful in the treatment of nitric oxide synthase mediated diseases and disorders. STR1