372144-12-2 Usage
General Description
3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID is a chemical compound with the molecular formula C16H24N2O4. It is a derivative of piperidine and propionic acid, and it contains a carbobenzyloxy (CBZ) protecting group on the amino group. 3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID is commonly used in the pharmaceutical industry as a building block for the synthesis of various pharmaceutical drugs. It has been studied for its potential therapeutic applications, including as an anti-inflammatory and analgesic agent. 3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID is characterized by its ability to selectively modify specific functional groups and has demonstrated potential in medicinal chemistry research for the development of new drug candidates.
Check Digit Verification of cas no
The CAS Registry Mumber 372144-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,2,1,4 and 4 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 372144-12:
(8*3)+(7*7)+(6*2)+(5*1)+(4*4)+(3*4)+(2*1)+(1*2)=122
122 % 10 = 2
So 372144-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N2O4/c19-15(20)9-14(13-7-4-8-17-10-13)18-16(21)22-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-11H2,(H,18,21)(H,19,20)