375368-85-7 Usage
General Description
5-Cyano-2-fluoro-6-picoline is a specialty chemical often used in various chemical reactions and research experiments. Its chemical formula is C7H4FN3 and its molecular weight is 151.13 g/mol. The chemical is known for certain characteristics such as its clear, colorless to light yellow liquid appearance and stable properties under normal conditions. Despite its stable nature, it should be handled with caution since it is often categorized as an irritating and harmful substance. Therefore, it requires careful handling and storage, primarily in a cool, well-ventilated area. It is frequently utilized in the field of pharmaceuticals, specifically in the synthesis of various compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 375368-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,5,3,6 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 375368-85:
(8*3)+(7*7)+(6*5)+(5*3)+(4*6)+(3*8)+(2*8)+(1*5)=187
187 % 10 = 7
So 375368-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN2/c1-5-6(4-9)2-3-7(8)10-5/h2-3H,1H3
