378223-36-0 Usage
General Description
3-Benzyl-2-oxazolidinecarboxylic acid is a chemical compound with the molecular formula C11H13NO3. It belongs to the class of oxazolidinecarboxylic acids and has a benzyl group attached to the 3-position of the oxazolidine ring. 3-BENZYL-2-OXAZOLIDINECARBOXYLIC ACID has been studied for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. It exhibits interesting biological activities and can serve as a building block for the synthesis of various bioactive compounds. 3-Benzyl-2-oxazolidinecarboxylic acid has the potential to be used for the development of new drugs and pharmaceuticals due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 378223-36-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,8,2,2 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 378223-36:
(8*3)+(7*7)+(6*8)+(5*2)+(4*2)+(3*3)+(2*3)+(1*6)=160
160 % 10 = 0
So 378223-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO3/c13-11(14)10-12(6-7-15-10)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,14)
