381241-08-3 Usage
General Description
FMOC-1,2-TRANS-ACHC-OH is a chemical compound with the molecular formula C23H21NO4. It is a derivative of the amino acid derivatives 1-aminocyclohexanecarboxylic acid (ACHC) and 9-fluorenylmethyloxycarbonyl (FMOC). FMOC-1,2-TRANS-ACHC-OH is commonly used in peptide synthesis and organic chemistry research, as it can be employed as a protecting group for the N-terminal of peptides and proteins. FMOC-1,2-TRANS-ACHC-OH has the potential to be used in the development of new pharmaceuticals and bioactive compounds due to its versatile properties and its ability to influence the structure and function of peptides and proteins.
Check Digit Verification of cas no
The CAS Registry Mumber 381241-08-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,1,2,4 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 381241-08:
(8*3)+(7*8)+(6*1)+(5*2)+(4*4)+(3*1)+(2*0)+(1*8)=123
123 % 10 = 3
So 381241-08-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H23NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-4,7-10,18-20H,5-6,11-13H2,(H,23,26)(H,24,25)/t18-,20-/m1/s1