381721-55-7 Usage
General Description
1-(2-Imidazol-1-yl-ethyl)-piperazine is a chemical compound that is used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is a piperazine derivative with an imidazole group attached to the ethyl side chain. 1-(2-IMIDAZOL-1-YL-ETHYL)-PIPERAZINE is known to have potential pharmacological properties, including antiviral, antimicrobial, and antifungal activities. It has been studied for its potential use in the treatment of various medical conditions, including anxiety, depression, and neurological disorders. Additionally, it has been investigated for its potential as a drug delivery agent and a targeting ligand for specific receptors. Overall, 1-(2-imidazol-1-yl-ethyl)-piperazine is a versatile chemical compound with potential applications in the medical and pharmaceutical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 381721-55-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,1,7,2 and 1 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 381721-55:
(8*3)+(7*8)+(6*1)+(5*7)+(4*2)+(3*1)+(2*5)+(1*5)=147
147 % 10 = 7
So 381721-55-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H16N4/c1-4-12(5-2-10-1)7-8-13-6-3-11-9-13/h3,6,9-10H,1-2,4-5,7-8H2