38186-85-5 Usage
General Description
"2-Bromo-5-fluoro-3-picoline" is a chemical compound with the molecular formula C6H4BrFN. It is an organic compound consisting of a pyridine ring with bromine, fluorine, and methyl groups attached. 2-Bromo-5-fluoro-3-picoline is used in the synthesis of various pharmaceuticals and agrochemicals. It is also used as a building block in the preparation of complex organic molecules, making it an important intermediate in the chemical industry. Additionally, it has applications in chemical research and development. Its unique structure and properties make it valuable for various chemical processes and industries.
Check Digit Verification of cas no
The CAS Registry Mumber 38186-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 38186-85:
(7*3)+(6*8)+(5*1)+(4*8)+(3*6)+(2*8)+(1*5)=145
145 % 10 = 5
So 38186-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFN/c1-4-2-5(8)3-9-6(4)7/h2-3H,1H3