38385-95-4 Usage
General Description
2-PIPERIDIN-4-YL-1H-BENZOIMIDAZOLE is a chemical compound with a molecular formula of C15H18N4. It is a heterocyclic compound containing a benzimidazole ring and a piperidine ring. This chemical has been studied for its potential pharmaceutical properties, including as an anti-cancer agent, and as a potential treatment for various medical conditions such as psychiatric disorders and infectious diseases. Its unique structure and potential therapeutic effects make it an interesting compound for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 38385-95-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,3,8 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 38385-95:
(7*3)+(6*8)+(5*3)+(4*8)+(3*5)+(2*9)+(1*5)=154
154 % 10 = 4
So 38385-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,15)