389621-79-8 Usage
Description
(3-AMINO-5-NITROPHENYL)BORONIC ACID HCL SALT is an organic compound that serves as a crucial reagent in the synthesis of heterocycle carboxamides. It is characterized by its unique chemical structure, which includes an amino group, a nitro group, and a boronic acid group. (3-AMINO-5-NITROPHENYL)BORONIC ACID HCL SALT plays a significant role in the development of pharmaceuticals, particularly in the treatment of immunological and oncological disorders.
Uses
Used in Pharmaceutical Industry:
(3-AMINO-5-NITROPHENYL)BORONIC ACID HCL SALT is used as a key reagent for the preparation of heterocycle carboxamides. These carboxamides are essential in the development of Bruton's tyrosine kinase (Btk) inhibitors, which are vital for treating various immunological and oncological disorders. (3-AMINO-5-NITROPHENYL)BORONIC ACID HCL SALT's unique structure allows for the creation of effective inhibitors that can modulate the activity of Btk, a protein that plays a crucial role in the immune system and has been implicated in the development of certain cancers.
In the field of immunology, Btk inhibitors derived from (3-AMINO-5-NITROPHENYL)BORONIC ACID HCL SALT can be employed to target B cells, which are involved in the production of antibodies and the regulation of immune responses. By inhibiting Btk, these compounds can help regulate the immune system and provide relief from autoimmune diseases such as rheumatoid arthritis and systemic lupus erythematosus.
In oncology, Btk inhibitors have shown promise in the treatment of certain types of cancer, particularly those that involve the overactivation of the Btk protein. By inhibiting Btk, these compounds can help prevent the uncontrolled growth and proliferation of cancer cells, offering a potential therapeutic approach for patients with various types of malignancies.
Check Digit Verification of cas no
The CAS Registry Mumber 389621-79-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,9,6,2 and 1 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 389621-79:
(8*3)+(7*8)+(6*9)+(5*6)+(4*2)+(3*1)+(2*7)+(1*9)=198
198 % 10 = 8
So 389621-79-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BN2O4.ClH/c8-5-1-4(7(10)11)2-6(3-5)9(12)13;/h1-3,10-11H,8H2;1H