391248-18-3 Usage
General Description
Boronic acid, (2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)- (9CI) is a chemical compound that contains a boronic acid group attached to a tetrahydrobenzoquinolizinyl ring. Boronic acids are known for their unique reactivity with diols and amines, making them useful in various chemical reactions, such as Suzuki coupling and recognition of carbohydrates and nucleic acids. This specific compound, with its tetrahydrobenzoquinolizinyl ring, may have potential applications in medicinal chemistry, as compounds containing similar ring structures have been studied for their potential pharmacological activities. Overall, this chemical represents a potentially valuable building block for the synthesis of diverse organic compounds with specialized properties.
Check Digit Verification of cas no
The CAS Registry Mumber 391248-18-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,1,2,4 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 391248-18:
(8*3)+(7*9)+(6*1)+(5*2)+(4*4)+(3*8)+(2*1)+(1*8)=153
153 % 10 = 3
So 391248-18-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16BNO2/c15-13(16)11-7-9-3-1-5-14-6-2-4-10(8-11)12(9)14/h7-8,15-16H,1-6H2
