394655-10-8 Usage
General Description
3-AMINO-2-PIPERAZIN-1-YLBENZOIC ACID, also known as 3-APPA, is a chemical compound with the molecular formula C12H15N3O2. It is a derivative of piperazine and has a benzoic acid structure with an amino group attached at the 3-position. 3-AMINO-2-PIPERAZIN-1-YLBENZOIC ACID has medical and pharmaceutical applications, including its use as a building block in the synthesis of various pharmaceutical agents. Additionally, it has been studied for its potential use in the treatment of certain neurodegenerative disorders and as an anticancer agent. The compound's structure and properties make it a versatile building block for the synthesis of diverse chemical compounds with potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 394655-10-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,4,6,5 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 394655-10:
(8*3)+(7*9)+(6*4)+(5*6)+(4*5)+(3*5)+(2*1)+(1*0)=178
178 % 10 = 8
So 394655-10-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O2/c12-9-3-1-2-8(11(15)16)10(9)14-6-4-13-5-7-14/h1-3,13H,4-7,12H2,(H,15,16)