39890-46-5 Usage
General Description
4-[2-(Piperazin-1-yl)acetyl]morpholine is a specialized chemical compound that combines elements from piperazine and morpholine structures. Piperazine is a versatile organic compound often used in fields like pharmaceuticals, whereas Morpholine is a common organic solvent used in various industries. When these two are acetylated, it results in a compound that holds potential as an intermediary for creating specialized drugs or chemicals. However, detailed attributes such as its physical and chemical properties, hazards, uses, and mode of reaction with other substances are not widely documented or well-known. It is crucial for chemists and users to handle this compound carefully and understand the safety precautions associated with it.
Check Digit Verification of cas no
The CAS Registry Mumber 39890-46-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,8,9 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 39890-46:
(7*3)+(6*9)+(5*8)+(4*9)+(3*0)+(2*4)+(1*6)=165
165 % 10 = 5
So 39890-46-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H19N3O2/c14-10(13-5-7-15-8-6-13)9-12-3-1-11-2-4-12/h11H,1-9H2/p+2