400727-69-7 Usage
Description
5-NITROISOINDOLINE HYDROCHLORIDE is an organic compound that serves as a crucial reagent in the synthesis of various pharmaceutical compounds. It is characterized by its ability to form different chemical structures, making it a versatile component in the field of organic chemistry.
Uses
Used in Pharmaceutical Industry:
5-NITROISOINDOLINE HYDROCHLORIDE is used as a reagent for the organic synthesis of biphenylcarboxamidoisoindoline derivatives. These derivatives act as apolipoprotein B secretion inhibitors, which are essential in the treatment of conditions related to lipid metabolism, such as hyperlipidemia and atherosclerosis.
5-NITROISOINDOLINE HYDROCHLORIDE is also used as a reagent in the synthesis of benzenesulfonamides. These compounds have the potential to act as antipsychotic agents, playing a significant role in the development of medications for the treatment of psychiatric disorders, such as schizophrenia and bipolar disorder.
Check Digit Verification of cas no
The CAS Registry Mumber 400727-69-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,0,7,2 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 400727-69:
(8*4)+(7*0)+(6*0)+(5*7)+(4*2)+(3*7)+(2*6)+(1*9)=117
117 % 10 = 7
So 400727-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O2.ClH/c11-10(12)8-2-1-6-4-9-5-7(6)3-8;/h1-3,9H,4-5H2;1H
