40133-08-2 Usage
General Description
5,6,7,8-Tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylic acid is a chemical compound with a molecular formula C9H12O2S. It is a carboxylic acid derivative that contains a seven-membered ring with a sulfur atom and a carboxylic acid group attached to it. 5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[B]THIOPHENE-2-CARBOXYLIC ACID is commonly used in organic synthesis and pharmaceutical research due to its unique structural features and potential biological activities. It may have important pharmacological properties and can be used as a building block for the synthesis of various drug molecules. Furthermore, its cyclic structure and reactivity make it a valuable intermediate in the production of diverse chemical and pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 40133-08-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,3 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40133-08:
(7*4)+(6*0)+(5*1)+(4*3)+(3*3)+(2*0)+(1*8)=62
62 % 10 = 2
So 40133-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O2S/c11-10(12)9-6-7-4-2-1-3-5-8(7)13-9/h6H,1-5H2,(H,11,12)