4076-39-5 Usage
Chemical classification
1-Methylbenzo[c]phenanthrene is a polycyclic aromatic hydrocarbon (PAH) compound, which is a class of organic compounds consisting of multiple aromatic rings.
Derivative
It is a derivative of phenanthrene, which is a type of PAH consisting of three fused benzene rings.
Carcinogenicity
This compound is known to be carcinogenic, meaning it has the potential to cause cancer in humans and animals.
Genotoxic and mutagenic properties
The compound has been shown to exhibit genotoxicity, which refers to its ability to damage DNA, and mutagenicity, which is its capability to induce mutations in genetic material. These properties contribute to its carcinogenic nature.
Cancer risk
1-Methylbenzo[c]phenanthrene is associated with an increased risk of cancer, particularly lung cancer, due to its ability to damage DNA and induce mutations.
Check Digit Verification of cas no
The CAS Registry Mumber 4076-39-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,7 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4076-39:
(6*4)+(5*0)+(4*7)+(3*6)+(2*3)+(1*9)=85
85 % 10 = 5
So 4076-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H14/c1-13-5-4-7-15-11-12-16-10-9-14-6-2-3-8-17(14)19(16)18(13)15/h2-12H,1H3
