408531-38-4 Usage
Description
2-Cyanoquinoline-4-carboxylic acid is a heterocyclic compound that features a quinoline ring fused with a pyridine ring, with a cyano group and a carboxylic acid group attached. This unique structure endows it with potential pharmaceutical applications, making it a valuable building block for the synthesis of biologically active compounds. Its anti-tumor, anti-inflammatory, and anti-bacterial properties have been the subject of research, and it serves as a precursor in the development of new drug candidates.
Uses
Used in Pharmaceutical Industry:
2-Cyanoquinoline-4-carboxylic acid is used as a building block for the synthesis of various biologically active compounds due to its unique structure and reactivity. It is particularly valuable for the development of new drugs and pharmaceuticals.
Used in Anti-tumor Applications:
2-Cyanoquinoline-4-carboxylic acid is used as a precursor in the synthesis of potential drug candidates with anti-tumor properties, targeting the development of new cancer treatments.
Used in Anti-inflammatory Applications:
2-CYANOQUINOLINE-4-CARBOXYLIC ACID is used as a starting material for the synthesis of anti-inflammatory agents, leveraging its potential to modulate inflammatory responses.
Used in Anti-bacterial Applications:
2-Cyanoquinoline-4-carboxylic acid is utilized as a precursor in the development of anti-bacterial drugs, contributing to the fight against bacterial infections.
Check Digit Verification of cas no
The CAS Registry Mumber 408531-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,8,5,3 and 1 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 408531-38:
(8*4)+(7*0)+(6*8)+(5*5)+(4*3)+(3*1)+(2*3)+(1*8)=134
134 % 10 = 4
So 408531-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H6N2O2/c12-6-7-5-9(11(14)15)8-3-1-2-4-10(8)13-7/h1-5H,(H,14,15)
