4100-19-0 Usage
Type of compound
Heterocyclic compound
Structure
Five-membered ring composed of three carbon atoms, one nitrogen atom, and one sulfur atom
Functional group
Carbohydrazide group (C(=O)NNH2) attached to the nitrogen atom in the ring
Potential applications
Pharmaceutical and agricultural industries
Biological activities
Antimicrobial, anticonvulsant, and antitumor properties
Research value
Unique structure and diverse biological activities make it a valuable target for further research and potential development of new drugs and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 4100-19-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,0 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4100-19:
(6*4)+(5*1)+(4*0)+(3*0)+(2*1)+(1*9)=40
40 % 10 = 0
So 4100-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N4OS/c4-6-3(8)2-1-5-7-9-2/h1H,4H2,(H,6,8)
