415943-88-3 Usage
Description
5-(4-Methoxy-2-nitrophenyl)-2-furaldehyde is a chemical compound with the molecular formula C12H9NO5. It is a yellow crystalline solid that is commonly used in organic synthesis and as a building block for the synthesis of various pharmaceuticals and agrochemicals. 5-(4-METHOXY-2-NITROPHENYL)-2-FURALDEHYDE is known for its nitro and methoxy substituents on the benzene ring, as well as its aldehyde and furan functional groups, making it useful for various reactions such as nucleophilic addition and substitution. It is also known to exhibit various biological activities, making it a potential candidate for drug development.
Uses
Used in Pharmaceutical Industry:
5-(4-Methoxy-2-nitrophenyl)-2-furaldehyde is used as a building block for the synthesis of various pharmaceuticals due to its versatile chemical structure and functional groups. Its ability to participate in nucleophilic addition and substitution reactions allows for the creation of a wide range of drug candidates.
Used in Agrochemical Industry:
5-(4-Methoxy-2-nitrophenyl)-2-furaldehyde is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structure and functional groups enable the development of novel and effective compounds for agricultural applications.
Used in Organic Synthesis:
5-(4-Methoxy-2-nitrophenyl)-2-furaldehyde is used as a key intermediate in organic synthesis for the preparation of various organic compounds. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules.
Used in Drug Development:
5-(4-Methoxy-2-nitrophenyl)-2-furaldehyde is used as a potential candidate for drug development due to its demonstrated biological activities. Its ability to participate in various chemical reactions allows for the modification and optimization of its properties to target specific therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 415943-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,5,9,4 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 415943-88:
(8*4)+(7*1)+(6*5)+(5*9)+(4*4)+(3*3)+(2*8)+(1*8)=163
163 % 10 = 3
So 415943-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO5/c1-17-8-2-4-10(11(6-8)13(15)16)12-5-3-9(7-14)18-12/h2-7H,1H3
415943-88-3Relevant articles and documents
5-Aryl-2-furaldehydes in the synthesis of tetrahydropyrimidinones by Biginelli reaction
Vakhula, Andriy R.,Horak, Yuriy I.,Lytvyn, Roman Z.,Lesyuk, Alexandra I.,Kinzhybalo, Vasyl,Zubkov, Fedor I.,Obushak, Mykola D.
, p. 545 - 549 (2018/07/05)
5-Aryl-2-furaldehydes, obtained by furfural arylation with arenediazonium salts, react with ethyl acetoacetate or acetylacetone and (thio)- urea in the presence of FeCl3·6H2O as a catalyst. A series of ethyl 4-(5-aryl-2-furyl)-6-methyl-2-oxo(thioxo)-1,2,3,4-tetrahydropyrimidine- 5-carboxylates was obtained.
A new simple route to the thieno[2,3-b]indole ring system
Butin, Alexander V.,Tsiunchik, Fatima A.,Abaev, Vladimir T.,Zavodnik, Valery E.
experimental part, p. 1145 - 1148 (2009/04/06)
A simple and effective method has been elaborated for the synthesis of thieno[2,3-b]indole ring system. It is based on the electrophilic recyclization of 2-alkyl-5-(2-isothiocyanoaryl)furans in the presence of anhydrous AlCl 3. Georg Thieme Ver
