41600-42-4 Usage
Pyridine carboxylic acid group
The compound belongs to a group of chemical compounds that are derivatives of pyridine, which is a heterocyclic aromatic organic compound, and have one or more carboxylic acid groups attached to the pyridine ring.
Methyl group
A carbon atom with three hydrogen atoms attached to it, which is a part of the 1-methyl-4-oxo-pyridine-2,6-dicarboxylic acid molecule, contributing to its structure and properties.
Carbonyl group
A functional group consisting of a carbon atom double-bonded to an oxygen atom (C=O), which is present in the 1-methyl-4-oxo-pyridine-2,6-dicarboxylic acid molecule, influencing its reactivity and properties.
Two carboxylic acid groups
The compound contains two -COOH groups, which are responsible for its acidic properties and ability to form salts and esters.
Pharmaceutical industry use
1-methyl-4-oxo-pyridine-2,6-dicarboxylic acid is commonly used in the pharmaceutical industry for the synthesis of various drugs and pharmaceutical products, making it an important building block in the development of new medications.
Chelating agent potential
The compound has the potential to act as a chelating agent, which means it can bind to metal ions, forming complexes and helping to stabilize or separate metal ions in various chemical reactions and processes.
Metal complex formation
1-methyl-4-oxo-pyridine-2,6-dicarboxylic acid can form complexes with metals, which may have applications in areas such as catalysis, materials science, and medicinal chemistry.
Anti-inflammatory properties
The compound has been studied for its potential anti-inflammatory properties, which could make it useful in the development of treatments for conditions such as arthritis, asthma, and other inflammatory diseases.
Antioxidant properties
1-methyl-4-oxo-pyridine-2,6-dicarboxylic acid has also been studied for its potential antioxidant properties, which could have applications in the prevention and treatment of various diseases and conditions associated with oxidative stress, such as cancer, cardiovascular diseases, and neurodegenerative disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 41600-42-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,6,0 and 0 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 41600-42:
(7*4)+(6*1)+(5*6)+(4*0)+(3*0)+(2*4)+(1*2)=74
74 % 10 = 4
So 41600-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO5/c1-9-5(7(11)12)2-4(10)3-6(9)8(13)14/h2-3H,1H3,(H,11,12)(H,13,14)
