42780-28-9 Usage
Molecular weight
247.29 g/mol This is the mass of one mole of 2,5-Dimethyl-1-(3-methoxyphenyl)-1H-pyrrole-3-acetic acid, measured in grams per mole.
Pyrrole ring structure
This is the five-membered ring structure in the molecule that consists of one nitrogen atom and four carbon atoms.
Carboxylic acid functional group
This is the functional group in the molecule that consists of a carbonyl group (C=O) and a hydroxyl group (-OH) bonded to the same carbon atom.
Anti-inflammatory and analgesic effects
These are the potential therapeutic properties of 2,5-Dimethyl-1-(3-methoxyphenyl)-1H-pyrrole-3-acetic acid that have been studied in pharmaceutical research.
Potential candidate for the treatment of pain and inflammatory conditions
Due to its anti-inflammatory and analgesic effects, 2,5-Dimethyl-1-(3-methoxyphenyl)-1H-pyrrole-3-acetic acid could be used to treat conditions that involve pain and inflammation.
Interesting target for further studies in medicinal chemistry and drug discovery
The unique structure and properties of 2,5-Dimethyl-1-(3-methoxyphenyl)-1H-pyrrole-3-acetic acid make it a promising target for further research in the field of drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 42780-28-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,7,8 and 0 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 42780-28:
(7*4)+(6*2)+(5*7)+(4*8)+(3*0)+(2*2)+(1*8)=119
119 % 10 = 9
So 42780-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO3/c1-10-7-12(8-15(17)18)11(2)16(10)13-5-4-6-14(9-13)19-3/h4-7,9H,8H2,1-3H3,(H,17,18)
