435345-36-1 Usage
Description
BENZO[1,3]DIOXOL-5-YLMETHYL-[2-(4-FLUORO-PHENYL)-ETHYL]-AMINE is a chemical compound belonging to the amine class of organic compounds, with the molecular formula C16H16FNO2. It features a benzodioxole moiety attached to a 2-(4-fluorophenyl)ethylamine group, which may contribute to its potential applications in the pharmaceutical or chemical industries. However, its specific uses and properties have not been extensively studied or documented.
Uses
Used in Pharmaceutical Industry:
BENZO[1,3]DIOXOL-5-YLMETHYL-[2-(4-FLUORO-PHENYL)-ETHYL]-AMINE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its unique structure and functional groups.
Used in Chemical Industry:
BENZO[1,3]DIOXOL-5-YLMETHYL-[2-(4-FLUORO-PHENYL)-ETHYL]-AMINE is used as a building block in the development of new chemical entities for various applications, such as agrochemicals, dyes, or materials science, owing to its distinct molecular structure and potential reactivity.
As with all chemicals, proper handling and safety precautions should be taken when working with BENZO[1,3]DIOXOL-5-YLMETHYL-[2-(4-FLUORO-PHENYL)-ETHYL]-AMINE to prevent any potential health or environmental risks.
Check Digit Verification of cas no
The CAS Registry Mumber 435345-36-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,5,3,4 and 5 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 435345-36:
(8*4)+(7*3)+(6*5)+(5*3)+(4*4)+(3*5)+(2*3)+(1*6)=141
141 % 10 = 1
So 435345-36-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H16FNO2/c17-14-4-1-12(2-5-14)7-8-18-10-13-3-6-15-16(9-13)20-11-19-15/h1-6,9,18H,7-8,10-11H2/p+1
