436087-14-8 Usage
General Description
3-(2,3-dihydro-benzo[1,4]dioxin-6-ylamino)-propionic acid is a chemical compound that contains a dihydrobenzodioxin moiety and a propionic acid group. It is classified as an amino acid derivative and is commonly used as a building block in organic and medicinal chemistry. 3-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YLAMINO)-PROPIONIC ACID may have potential applications in pharmaceutical research and drug development due to its unique structure and potential biological activities. However, further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 436087-14-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 436087-14:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*7)+(2*1)+(1*4)=148
148 % 10 = 8
So 436087-14-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO4/c13-11(14)3-4-12-8-1-2-9-10(7-8)16-6-5-15-9/h1-2,7,12H,3-6H2,(H,13,14)/p-1
