436089-19-9 Usage
General Description
N-(4-AMINO-2-METHOXY-PHENYL)-2-METHYL-BENZAMIDE is a chemical compound with the molecular formula C15H16N2O2. It is a benzamide derivative with a methyl group and an amino group attached to a phenyl ring. N-(4-AMINO-2-METHOXY-PHENYL)-2-METHYL-BENZAMIDE may have potential applications in the field of medicinal chemistry and drug discovery, as benzamides are known to have various biological activities, including anticancer, antipsychotic, and anti-inflammatory properties. Further research is needed to fully understand the potential uses and effects of N-(4-AMINO-2-METHOXY-PHENYL)-2-METHYL-BENZAMIDE.
Check Digit Verification of cas no
The CAS Registry Mumber 436089-19-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 436089-19:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*9)+(2*1)+(1*9)=159
159 % 10 = 9
So 436089-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O2/c1-10-5-3-4-6-12(10)15(18)17-13-8-7-11(16)9-14(13)19-2/h3-9H,16H2,1-2H3,(H,17,18)