436092-88-5 Usage
Description
4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine, a tetrazole derivative and aromatic amine with the molecular formula C11H14N4, is a chemical compound that serves as an intermediate in the synthesis of various pharmaceuticals and organic compounds. It has been studied for its potential biological activities, including antimicrobial and anticancer properties, and has been identified as a potential precursor in the development of new chemical entities for medicinal and industrial applications.
Uses
Used in Pharmaceutical Industry:
4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic benefits.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine is used as a building block for the creation of complex organic compounds, leveraging its unique chemical structure to form novel molecules with specific properties.
Used in Antimicrobial Applications:
4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine is studied for its antimicrobial properties, potentially serving as an active ingredient in antimicrobial agents to combat various types of bacteria and other microorganisms.
Used in Anticancer Research:
4-(2-ETHYL-2H-TETRAZOL-5-YL)-PHENYLAMINE is explored for its anticancer properties, with the aim of developing new therapeutic agents that could target and inhibit the growth of cancer cells, offering new treatment options for cancer patients.
Used in Medicinal Chemistry:
4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine is utilized in medicinal chemistry as a precursor for the development of new chemical entities, which could lead to innovative treatments and pharmaceuticals with improved efficacy and safety profiles.
Used in Industrial Applications:
Beyond medicinal uses, 4-(2-Ethyl-2H-tetrazol-5-yl)-phenylamine is also considered for its potential in various industrial applications, where its unique chemical properties may be harnessed for specific technical or manufacturing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 436092-88-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,9 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 436092-88:
(8*4)+(7*3)+(6*6)+(5*0)+(4*9)+(3*2)+(2*8)+(1*8)=155
155 % 10 = 5
So 436092-88-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5/c1-2-14-12-9(11-13-14)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3
