436096-82-1 Usage
Description
(4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE is a complex organic chemical compound characterized by the presence of an isopropyl-benzyl group and a tetrahydrofuran-2-yl-methylamine group. The isopropyl-benzyl group features an isopropyl group connected to a benzene ring, while the tetrahydrofuran-2-yl-methylamine group includes a tetrahydrofuran ring and a methylamine group. (4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE holds potential for a range of applications in chemical synthesis and reactions, with its specific uses and properties contingent upon the context and purpose for which it is utilized.
Usage:
Used in Chemical Synthesis:
(4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE is used as a building block for the synthesis of various complex organic molecules. Its unique molecular structure, which includes both an isopropyl-benzyl and a tetrahydrofuran-2-yl-methylamine group, allows it to participate in a wide array of chemical reactions, facilitating the creation of diverse chemical products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE may be utilized as an intermediate in the development of new drugs. Its structural features could be exploited to design molecules with specific biological activities, potentially leading to the creation of novel therapeutic agents.
Used in Material Science:
(4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE could also find applications in material science, where it might be employed to develop new polymers or other advanced materials with unique properties. (4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE's structural components could contribute to the formation of materials with enhanced characteristics, such as improved strength, flexibility, or chemical resistance.
Used in Research and Development:
As a chemical compound with a distinctive molecular structure, (4-ISOPROPYL-BENZYL)(TETRAHYDROFURAN-2-YL-METHYL)AMINE may be valuable in research and development settings. Scientists and chemists can use this compound to explore new reaction pathways, investigate its reactivity with other molecules, and gain insights into its potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 436096-82-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,9 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 436096-82:
(8*4)+(7*3)+(6*6)+(5*0)+(4*9)+(3*6)+(2*8)+(1*2)=161
161 % 10 = 1
So 436096-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H23NO/c1-12(2)14-7-5-13(6-8-14)10-16-11-15-4-3-9-17-15/h5-8,12,15-16H,3-4,9-11H2,1-2H3/p+1/t15-/m0/s1
