4382-39-2 Usage
General Description
The chemical "3,5-Dichloro-2,4-dihydroxy-6-methylbenzoic acid 3-hydroxy-4-(methoxycarbonyl)-5-methylphenyl ester" is a compound that contains two dihydroxybenzoic acid groups, as well as chloro, methyl, and methoxycarbonyl functional groups. It is a phenyl ester derivative of 3,5-Dichloro-2,4-dihydroxy-6-methylbenzoic acid, and has a hydroxy and methoxycarbonyl substitution at the 3 and 4 positions of the phenyl ring. 3,5-Dichloro-2,4-dihydroxy-6-methylbenzoic acid 3-hydroxy-4-(methoxycarbonyl)-5-methylphenyl ester may have potential applications in the pharmaceutical and chemical industries due to its unique structure and properties, but further research would be needed to determine its specific uses and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 4382-39-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,8 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4382-39:
(6*4)+(5*3)+(4*8)+(3*2)+(2*3)+(1*9)=92
92 % 10 = 2
So 4382-39-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H14Cl2O7/c1-6-4-8(5-9(20)10(6)16(23)25-3)26-17(24)11-7(2)12(18)15(22)13(19)14(11)21/h4-5,20-22H,1-3H3