439118-88-4 Usage
General Description
Ethyl 5-oxo-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-8-carboxylate, also known as ETI-01884, is a chemical compound with a complex molecular structure. It belongs to the class of imidazo[1,2-a]pyridine derivatives, which have shown potential pharmaceutical properties. ETI-01884 is a heterocyclic compound that contains an imidazo[1,2-a]pyridine core with an ethyl ester and a carboxylic acid group attached to it. Ethyl 5-oxo-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-8-carboxylate has attracted interest in medicinal chemistry due to its potential biological activities, especially in the field of drug discovery and development. Its unique structure and properties make it a promising candidate for further research and potential applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 439118-88-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,9,1,1 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 439118-88:
(8*4)+(7*3)+(6*9)+(5*1)+(4*1)+(3*8)+(2*8)+(1*8)=164
164 % 10 = 4
So 439118-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O3/c1-2-15-10(14)7-3-4-8(13)12-6-5-11-9(7)12/h3-4,11H,2,5-6H2,1H3
