453-00-9 Usage
General Description
1,2-Dibromo-3-fluoropropane is a specialized brominated and fluorinated aliphatic compound with the molecular formula C3H4Br2F. As such, it combines elements of carbon, hydrogen, bromine, and fluorine. Due to its specific chemical structure and properties, this chemical is often used in various industrial and chemical synthesis applications. The presence of both bromine and fluorine atoms in its structure means that it can react in different ways under different conditions, making it a valuable chemical in certain research and industrial contexts. However, like many similar chemicals, 1,2-dibromo-3-fluoropropane must be handled with care to prevent harmful exposure or reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 453-00-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,5 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 453-00:
(5*4)+(4*5)+(3*3)+(2*0)+(1*0)=49
49 % 10 = 9
So 453-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H5Br2F/c4-1-3(5)2-6/h3H,1-2H2