45715-08-0 Usage
General Description
"(5-Methylpyridin-2-yl)methanamine" is a chemical compound that has the molecular formula C7H9N. It is a derivative of pyridine and contains a methyl group and an amine group. (5-METHYLPYRIDIN-2-YL)METHANAMINE is commonly used in the pharmaceutical and chemical industries for the synthesis of various organic compounds. It has a range of potential applications, including as a building block for the production of drugs, agrochemicals, and other fine chemicals. Additionally, it has been studied for its potential pharmacological properties and could have potential therapeutic uses. Overall, (5-Methylpyridin-2-yl)methanamine is a versatile and important chemical compound with various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 45715-08-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,7,1 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 45715-08:
(7*4)+(6*5)+(5*7)+(4*1)+(3*5)+(2*0)+(1*8)=120
120 % 10 = 0
So 45715-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2/c1-6-2-3-7(4-8)9-5-6/h2-3,5H,4,8H2,1H3
