459166-03-1 Usage
General Description
(S)-ALFA-AMINO-4-PIPERIDINE ACETIC ACID, also known as (S)-4-aminopiperidine-4-carboxylic acid or (S)-4-aminopiperidine-4-acetic acid, is a chemical compound with the molecular formula C7H14N2O2. It is an amino acid derivative and acts as an intermediate in the synthesis of pharmaceuticals and other organic compounds. (S)-ALFA-AMINO-4-PIPERIDINE ACETIC ACID is known for its importance in the pharmaceutical industry, as it is used in the synthesis of various medications, including antiviral and antidiabetic drugs. Additionally, it has potential applications in the field of agriculture as a building block in the development of new pesticides and herbicides. Its unique chemical structure and properties make (S)-ALFA-AMINO-4-PIPERIDINE ACETIC ACID a valuable and versatile compound with a wide range of potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 459166-03-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,9,1,6 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 459166-03:
(8*4)+(7*5)+(6*9)+(5*1)+(4*6)+(3*6)+(2*0)+(1*3)=171
171 % 10 = 1
So 459166-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2O2/c8-6(7(10)11)5-1-3-9-4-2-5/h5-6,9H,1-4,8H2,(H,10,11)/t6-/m0/s1
