49834-62-0 Usage
General Description
1H-Pyrazolo[3,4-b]pyridin-4-amine, also known as 4-Amino-1H-pyrazolo[3,4-b]pyridine, is a chemical compound that belongs to the class of pyrazolopyridines. It is a heterocyclic organic compound with a pyrazole ring fused to a pyridine ring, and an amino group located at the 4-position. 1H-Pyrazolo[3,4-b]pyridin-4-amine has potential applications in medicinal and pharmaceutical chemistry, as it has been studied for its biological activities, including its potential as a kinase inhibitor and its role in the development of new therapeutic agents. Additionally, it is used as a building block in the synthesis of various organic compounds. Its unique structure and properties make it a valuable molecule for research and potential application in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 49834-62-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,8,3 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 49834-62:
(7*4)+(6*9)+(5*8)+(4*3)+(3*4)+(2*6)+(1*2)=160
160 % 10 = 0
So 49834-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H,(H3,7,8,9,10)
