51255-96-0 Usage
Description
TRANS-ZEATIN GLUCOSIDE is a naturally occurring plant hormone belonging to the cytokinin family. It plays a crucial role in various aspects of plant growth and development, including cell division, differentiation, and nutrient signaling. Its chemical structure allows for efficient analysis and detection in various scientific applications.
Uses
Used in Analytical Chemistry:
TRANS-ZEATIN GLUCOSIDE is used as an analyte in the analytical studies for the acetylation of cytokinins and modified adenine compounds. This application is essential for gas chromatography-mass spectrometric analysis, which helps in the identification and quantification of these compounds in various samples.
Used in Plant Biology Research:
In the field of plant biology, TRANS-ZEATIN GLUCOSIDE is used as a research tool to study the effects of cytokinins on plant growth, development, and response to environmental stimuli. This knowledge contributes to the understanding of plant signaling pathways and can be applied to improve crop yield and stress resistance.
Used in Pharmaceutical Industry:
TRANS-ZEATIN GLUCOSIDE may also have potential applications in the pharmaceutical industry, particularly in the development of drugs targeting cell division and differentiation processes. Its role in plant growth and development could provide insights into similar processes in human cells, leading to the development of novel therapeutic strategies.
Used in Agriculture:
In agriculture, TRANS-ZEATIN GLUCOSIDE can be employed to enhance plant growth and improve crop yields. By understanding the role of cytokinins in plant development, farmers and researchers can optimize the use of growth regulators to increase productivity and ensure a sustainable food supply.
Check Digit Verification of cas no
The CAS Registry Mumber 51255-96-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,2,5 and 5 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 51255-96:
(7*5)+(6*1)+(5*2)+(4*5)+(3*5)+(2*9)+(1*6)=110
110 % 10 = 0
So 51255-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2+/t9-,11-,12+,13-,16-/m1/s1