51287-57-1 Usage
General Description
5-(benzoylamino)-N-(4-chlorophenyl)-3-methyl-4-isothiazolecarboxamide is a chemical compound with a complex molecular structure. It contains a benzoylamino group, a 4-chlorophenyl group, a 3-methyl-4-isothiazolecarboxamide group, and a nitrogen atom linking these groups together. 5-(benzoylamino)-N-(4-chlorophenyl)-3-methyl-4-isothiazolecarboxamide may have diverse applications in the field of medicine, as it contains an isothiazolecarboxamide, which is a known bioactive molecule with potential pharmaceutical properties. Additionally, the presence of a benzoylamino group suggests that it may have applications in organic chemistry and chemical synthesis. Further research and analysis are necessary to fully understand the potential uses and effects of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 51287-57-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,2,8 and 7 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 51287-57:
(7*5)+(6*1)+(5*2)+(4*8)+(3*7)+(2*5)+(1*7)=121
121 % 10 = 1
So 51287-57-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H14ClN3O2S/c1-11-15(17(24)20-14-9-7-13(19)8-10-14)18(25-22-11)21-16(23)12-5-3-2-4-6-12/h2-10H,1H3,(H,20,24)(H,21,23)