5177-15-1 Usage
Description
4-Methyl-6-methylamino-5-nitro-3H-pyrimidin-2-one is a chemical compound with the molecular formula C7H8N4O3. It is a derivative of pyrimidinone and contains a nitro and a methylamino group. This versatile chemical possesses unique properties and reactivity, making it a promising candidate for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
4-Methyl-6-methylamino-5-nitro-3H-pyrimidin-2-one is used as an intermediate in the synthesis of various drugs, particularly in the development of new pharmaceuticals. Its unique structure and reactivity contribute to the creation of innovative and effective medications.
Used in Research and Development:
In the field of research and development, 4-Methyl-6-methylamino-5-nitro-3H-pyrimidin-2-one serves as a building block for more complex organic compounds. Its properties make it a valuable component in the design and synthesis of advanced chemical entities for various applications.
Used in Chemical Synthesis:
4-Methyl-6-methylamino-5-nitro-3H-pyrimidin-2-one is utilized in chemical synthesis processes across different industries. Its versatility allows it to be incorporated into a wide range of products, from pharmaceuticals to specialty chemicals, enhancing their performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 5177-15-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,7 and 7 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5177-15:
(6*5)+(5*1)+(4*7)+(3*7)+(2*1)+(1*5)=91
91 % 10 = 1
So 5177-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O3/c1-3-4(10(12)13)5(7-2)9-6(11)8-3/h1-2H3,(H2,7,8,9,11)
