52086-09-6 Usage
Main Properties
1. Chemical Name: 2-AMINO-3-BROMO-9-FLUORENONE
2. Chemical formula: C13H8BrNO
3. Molecular Weight: 276.11 g/mol
4. Classification: Fluorenones
5. Structure: Fluorenone core with a bromine atom at position 3 and an amino group at position 2
Specific Content
1. Applications: Used in the synthesis of other organic compounds and as a reagent in chemical reactions.
2. Uses: Research, pharmaceuticals, and material science
3. Handling and Storage: Typically stored and handled under controlled conditions due to its potential hazards and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 52086-09-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,8 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 52086-09:
(7*5)+(6*2)+(5*0)+(4*8)+(3*6)+(2*0)+(1*9)=106
106 % 10 = 6
So 52086-09-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H8BrNO/c14-11-5-9-7-3-1-2-4-8(7)13(16)10(9)6-12(11)15/h1-6H,15H2