52175-10-7 Usage
General Description
Adenine phosphate, also known as adenosine monophosphate (AMP), is a nucleotide comprised of adenine, ribose, and a phosphate group. It is a fundamental component of nucleic acids such as RNA and ATP, the primary energy carrier in the cell. Adenine phosphate is involved in various cellular processes, including energy transfer and storage, signal transduction, and nucleic acid synthesis. It also plays a crucial role in the regulation of metabolism and cellular function. Additionally, adenine phosphate is utilized in biochemical and medical research as a reagent and substrate for various enzymatic assays and experimental protocols. Overall, adenine phosphate is an important molecule with diverse biological and chemical functions in the cell.
Check Digit Verification of cas no
The CAS Registry Mumber 52175-10-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,7 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52175-10:
(7*5)+(6*2)+(5*1)+(4*7)+(3*5)+(2*1)+(1*0)=97
97 % 10 = 7
So 52175-10-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5.H3O4P/c6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h1-2H,(H3,6,7,8,9,10);(H3,1,2,3,4)