52870-46-9 Usage
Description
Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylidene-, also known as a Schiff base derivative of cyclohexadiene, is a chemical compound with the molecular formula C18H22N2. It possesses a unique structure and reactivity, making it a valuable tool in chemical research and development.
Uses
Used in Organic Synthesis:
Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylideneis used as a building block in the synthesis of complex organic compounds. Its unique structure and reactivity make it a valuable tool in the preparation of various organic compounds.
Used in Medicinal Chemistry:
Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylidenehas potential applications in medicinal chemistry. It has been studied for its potential biological activities and pharmacological properties, making it a promising candidate for the development of new drugs and therapeutic agents.
Used in Materials Science:
Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylidenealso has potential applications in materials science. Its unique structure and properties can be utilized in the development of new materials with specific characteristics and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 52870-46-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,7 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 52870-46:
(7*5)+(6*2)+(5*8)+(4*7)+(3*0)+(2*4)+(1*6)=129
129 % 10 = 9
So 52870-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2/c1-14(2)13-15(3)19-17-9-11-18(12-10-17)20-16-7-5-4-6-8-16/h4-12,14-15H,13H2,1-3H3/b19-17-,20-18+
