52898-06-3 Usage
General Description
3-(3-Methoxy-5-isoxazolyl)propanoic acid is a chemical compound with the molecular formula C8H9NO4. It is a derivative of isoxazole and is commonly used in biological and medical research. It acts as an excitatory amino acid that modulates neurotransmission in the central nervous system by binding to the glutamate receptor. The compound has potential therapeutic applications in the treatment of neurological disorders, such as Alzheimer's disease and epilepsy. Additionally, it is also used as a building block in the synthesis of various pharmaceuticals and agrochemicals. Overall, 3-(3-Methoxy-5-isoxazolyl)propanoic acid plays a significant role in pharmacology and drug discovery due to its diverse biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 52898-06-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,9 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 52898-06:
(7*5)+(6*2)+(5*8)+(4*9)+(3*8)+(2*0)+(1*6)=153
153 % 10 = 3
So 52898-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO4/c1-11-6-4-5(12-8-6)2-3-7(9)10/h4H,2-3H2,1H3,(H,9,10)
