532440-94-1 Usage
General Description
3-Pyridinecarboxylicacid,2-amino-5-methyl-(9CI) is a chemical compound with the molecular formula C7H8N2O2. It is also known as 2-Amino-5-methylnicotinic acid and is commonly used in pharmaceutical and research applications. 3-Pyridinecarboxylicacid,2-amino-5-methyl-(9CI) is a derivative of nicotinic acid and is known for its potential biological activities, including anti-inflammatory, anti-tumor, and neuroprotective properties. It has been studied for its potential therapeutic uses in treating various diseases and conditions. Additionally, 3-Pyridinecarboxylicacid,2-amino-5-methyl-(9CI) is used as a building block in the synthesis of other chemical compounds. Its structure and properties make it a valuable component in the development of new drugs and research in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 532440-94-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,2,4,4 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 532440-94:
(8*5)+(7*3)+(6*2)+(5*4)+(4*4)+(3*0)+(2*9)+(1*4)=131
131 % 10 = 1
So 532440-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c1-4-2-5(7(10)11)6(8)9-3-4/h2-3H,1H3,(H2,8,9)(H,10,11)
