537013-52-8 Usage
Description
4-Chloro-2,6-difluorobenzyl bromide is an organic compound characterized by its molecular structure that features a benzene ring with a chlorine atom at the 4-position, two fluorine atoms at the 2 and 6 positions, and a bromine atom attached to the benzyl group. 4-Chloro-2,6-difluorobenzyl bromide is known for its reactivity and versatility in chemical synthesis, making it a valuable intermediate in the production of various pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Industry:
4-Chloro-2,6-difluorobenzyl bromide is used as an intermediate for the synthesis of various pharmaceuticals, including antibiotics, sedatives, and cancer treatments. Its unique molecular structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Organic Synthesis:
4-Chloro-2,6-difluorobenzyl bromide is frequently utilized in organic synthesis due to its reactivity and the ability to form a wide range of products. It serves as a building block for the creation of more complex organic molecules, which can be used in various applications, such as agrochemicals, dyes, and other specialty chemicals.
Used in Propellant Industry:
4-Chloro-2,6-difluorobenzyl bromide also finds application as a propellant in the chemical industry. Its properties make it suitable for use in the production of propellants for various purposes, such as in the aerospace and defense sectors, where high-performance propellants are required.
Check Digit Verification of cas no
The CAS Registry Mumber 537013-52-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,7,0,1 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 537013-52:
(8*5)+(7*3)+(6*7)+(5*0)+(4*1)+(3*3)+(2*5)+(1*2)=128
128 % 10 = 8
So 537013-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrClF2/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2