5410-01-5 Usage
General Description
The chemical "ethane-1,2-diylbis(oxybenzene-4,1-diyl)]bis(phenylmethanone)" is a compound with a complex molecular structure. It consists of two ethane molecules connected by a bis(oxybenzene) group, with a bis(phenylmethanone) group attached to each benzene ring. This chemical compound has potential applications in various fields such as pharmaceuticals, organic synthesis, and materials science. It may exhibit unique properties that make it useful in the development of new drugs, polymers, or other advanced materials. Further research and experimentation are necessary to fully understand the potential uses and effects of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 5410-01-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,1 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5410-01:
(6*5)+(5*4)+(4*1)+(3*0)+(2*0)+(1*1)=55
55 % 10 = 5
So 5410-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C28H22O4/c29-27(21-7-3-1-4-8-21)23-11-15-25(16-12-23)31-19-20-32-26-17-13-24(14-18-26)28(30)22-9-5-2-6-10-22/h1-18H,19-20H2
5410-01-5Relevant articles and documents
Transition Metal Compound and Catalyst Composition Comprising Same
-
Paragraph 0115-0117, (2022/02/05)
A novel transition metal compound and a catalyst composition including same are disclosed herein. In some embodiments, the transition metal compound is represented by formula 1 disclosed herein. In some embodiments, the catalyst composition comprises the transition metal compound represented by formula 1. The catalyst composition may be useful for preparing an olefin-based polymer having a high molecular weight in a low density region, and may be useful for preparing an olefin-based polymer having a low melting index (MI) in high temperature conditions and a high molecular weight.