54420-08-5 Usage
General Description
The chemical compound [(3S,4S,5S)-4-acetyloxy-5-(acetyloxymethyl)-5-methoxy-oxolan-3-yl] acetate is a type of acetylated sugar derivative. It is a specific type of acetate ester that contains a complex sugar molecule. The compound has a molecular structure that includes acetyl and methoxy functional groups. It is commonly used in various industrial and research applications, including as a building block for the synthesis of more complex organic compounds. This chemical may also have potential pharmaceutical and medicinal uses, but further research is needed to fully understand its biological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 54420-08-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,4,2 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 54420-08:
(7*5)+(6*4)+(5*4)+(4*2)+(3*0)+(2*0)+(1*8)=95
95 % 10 = 5
So 54420-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O8/c1-7(13)17-6-12(16-4)11(20-9(3)15)10(5-18-12)19-8(2)14/h10-11H,5-6H2,1-4H3/t10-,11-,12-/m0/s1