5457-16-9 Usage
Spiropiperidinyl derivative
2,3,4-trifluoro-N-phenylbenzamide
The compound is derived from 2,3,4-trifluoro-N-phenylbenzamide by incorporating a spiropiperidinyl structure.
3. Potential medicinal properties
The compound has possible therapeutic uses and may be beneficial in the development of new medications.
4. Pharmaceutical research application
It can be used in the field of pharmaceuticals for studying and understanding its specific properties, potential uses, and effects on the human body.
5. Caution required in handling and usage
Since the properties and potential uses of this chemical are still being studied, it is important to handle and use it with care to avoid any unintended consequences or hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 5457-16-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 7 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5457-16:
(6*5)+(5*4)+(4*5)+(3*7)+(2*1)+(1*6)=99
99 % 10 = 9
So 5457-16-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H18F3N3O3/c1-9-4-6-17(7-5-9)15(25)23(16(26)22-17)8-12(24)21-11-3-2-10(18)13(19)14(11)20/h2-3,9H,4-8H2,1H3,(H,21,24)(H,22,26)