56025-87-7 Usage
General Description
7-benzyl-2,6-dichloro-7H-purine is a chemical compound with the molecular formula C16H12Cl2N4. It is a derivative of purine, a heterocyclic organic compound that is commonly found in nucleic acids and has various biological activities. The presence of benzyl and dichloro groups in this compound gives it certain distinctive properties and potential applications. 7-benzyl-2,6-dichloro-7H-purine may have uses in pharmaceuticals, agrochemicals, and materials science due to its structural characteristics and potential reactivity. Moreover, it may serve as a valuable intermediate in the synthesis of other organic compounds with desired properties and applications. Overall, 7-benzyl-2,6-dichloro-7H-purine is a compound of interest with potential versatility and utility in various chemical and biological contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 56025-87-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,2 and 5 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56025-87:
(7*5)+(6*6)+(5*0)+(4*2)+(3*5)+(2*8)+(1*7)=117
117 % 10 = 7
So 56025-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H8Cl2N4/c13-10-9-11(17-12(14)16-10)15-7-18(9)6-8-4-2-1-3-5-8/h1-5,7H,6H2
