56617-66-4 Usage
Description
1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione is a complex organic compound with a unique molecular structure. It is characterized by its steroidal backbone and the presence of multiple functional groups, including hydroxyl and enone moieties. 1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione exhibits a range of biological activities and has potential applications in various fields due to its structural diversity and functional properties.
Uses
Used in Pharmaceutical Industry:
1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione is used as a pharmaceutical agent for its potential therapeutic effects. 1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs. Its ability to modulate cellular signaling pathways and affect cellular proliferation may contribute to its potential use in treating various diseases, including cancer.
Used in Chemical Research:
1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione is used as a research tool in the field of organic chemistry and biochemistry. Its complex structure and functional groups make it an interesting subject for studying molecular interactions, reaction mechanisms, and the development of new synthetic methods. Additionally, its potential biological activities may be investigated for understanding its mode of action and identifying new targets for drug discovery.
Used in Drug Delivery Systems:
Similar to gallotannin, 1β,3β-Dihydroxy-18-norandrost-5-eno[6,5,4-bc]furan-8,11,13-triene-7,17-dione may also be employed in the development of novel drug delivery systems. These systems could be designed to improve the compound's bioavailability, delivery, and therapeutic outcomes by utilizing various organic and metallic nanoparticles as carriers.
Check Digit Verification of cas no
The CAS Registry Mumber 56617-66-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,1 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56617-66:
(7*5)+(6*6)+(5*6)+(4*1)+(3*7)+(2*6)+(1*6)=144
144 % 10 = 4
So 56617-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H16O5/c1-19-11-4-2-8-9(3-5-12(8)20)15(11)17(23)18-16(19)10(7-24-18)13(21)6-14(19)22/h2,4,7,13-14,21-22H,3,5-6H2,1H3/t13-,14+,19-/m0/s1