58268-08-9 Usage
General Description
2-(1,3-Dioxolan-2-yl)thiophene is a chemical compound that contains a thiophene ring fused to a dioxolane ring. It is commonly used in organic synthesis and material science due to its unique chemical properties. 2-(1,3-DIOXOLAN-2-YL)THIOPHENE can be used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. It is also known for its potential application in the development of organic electronic devices, such as organic light-emitting diodes (OLEDs) and organic photovoltaic cells. Additionally, 2-(1,3-Dioxolan-2-yl)thiophene can be utilized as a ligand in coordination chemistry and as a precursor for the synthesis of other heterocyclic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 58268-08-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,2,6 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58268-08:
(7*5)+(6*8)+(5*2)+(4*6)+(3*8)+(2*0)+(1*8)=149
149 % 10 = 9
So 58268-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5,7H,3-4H2
