58878-37-8 Usage
Description
2-(2-Chloroethyl)-1-methylpiperidine hydrochloride, with the CAS number 58878-37-8, is an off-white solid compound that is utilized in various organic synthesis processes. It is a derivative of piperidine, a nitrogen-containing heterocyclic compound, which is known for its diverse applications in the chemical and pharmaceutical industries.
Uses
Used in Organic Synthesis:
2-(2-Chloroethyl)-1-methylpiperidine hydrochloride is used as an intermediate in the synthesis of various organic compounds. Its unique chemical structure allows it to be a valuable building block for creating a wide range of molecules with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(2-Chloroethyl)-1-methylpiperidine hydrochloride is used as a key component in the development of new drugs. Its versatile chemical properties enable it to be incorporated into the design of various therapeutic agents, potentially leading to the discovery of novel medications with improved efficacy and safety profiles.
Used in Chemical Research:
2-(2-Chloroethyl)-1-methylpiperidine hydrochloride is also employed in chemical research as a model compound for studying the reactivity and properties of piperidine derivatives. This helps researchers gain a deeper understanding of the structure-activity relationships and the potential applications of these compounds in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 58878-37-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,7 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58878-37:
(7*5)+(6*8)+(5*8)+(4*7)+(3*8)+(2*3)+(1*7)=188
188 % 10 = 8
So 58878-37-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H16ClN.ClH/c1-10-7-3-2-4-8(10)5-6-9;/h8H,2-7H2,1H3;1H