58893-13-3 Usage
Check Digit Verification of cas no
The CAS Registry Mumber 58893-13-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,9 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 58893-13:
(7*5)+(6*8)+(5*8)+(4*9)+(3*3)+(2*1)+(1*3)=173
173 % 10 = 3
So 58893-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C26H41N3O/c1-6-17(4)18-15-21-24-26(19-11-9-10-12-20(19)27(24)5)16-22(23(18)25(26)30)29(21)14-13-28(7-2)8-3/h9-12,17-18,21-25,30H,6-8,13-16H2,1-5H3
58893-13-3Relevant articles and documents
21-Deoxydihydroajmaline derivatives
-
, (2008/06/13)
Novel 21-deoxydihydroajmaline derivatives having the formula SPC1 Wherein R and R' are each the same alkyl group of 2 to 4 carbon atoms or R and R' together with the N atom with which they are associated form a saturated 5- or 6- atom ring, the atoms other than the nitrogen atom of which are all carbon atoms or one oxygen atom and the rest carbon atoms and X is the anion of a physiologically inorganic or organic acid, characterized by their antiarhythmic activity.