59021-07-7 Usage
Description
β-PYRAZINYLETHIOL ACETATE is a chemical compound characterized by the presence of a pyrazine ring, a thiol group, and an acetate (acetyl) functional group. This versatile molecule is known for its reactivity due to the thiol group, aromaticity from the pyrazine ring, and potential for π-π interactions in supramolecular chemistry. The acetate functionality can be hydrolyzed to produce the corresponding carboxylic acid, further broadening its synthetic applications. It serves as a valuable building block in the synthesis of pharmaceuticals and organic compounds, contributing to the development of a diverse range of products in the pharmaceutical and organic chemistry industries.
Uses
Used in Pharmaceutical Industry:
β-PYRAZINYLETHIOL ACETATE is used as a synthetic building block for the creation of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Chemistry:
In the field of organic chemistry, β-PYRAZINYLETHIOL ACETATE is utilized as a key intermediate in the synthesis of complex organic compounds. Its reactivity and structural features facilitate the formation of a wide array of chemical products.
Used in Supramolecular Chemistry:
β-PYRAZINYLETHIOL ACETATE is employed as a component in supramolecular chemistry, taking advantage of its π-π interactions to construct self-assembling systems and other complex molecular architectures.
Used in Chemical Synthesis:
The acetate functionality of β-PYRAZINYLETHIOL ACETATE allows for hydrolysis to the corresponding carboxylic acid, which is used in the synthesis of additional chemical compounds, expanding its utility in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 59021-07-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,0,2 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 59021-07:
(7*5)+(6*9)+(5*0)+(4*2)+(3*1)+(2*0)+(1*7)=107
107 % 10 = 7
So 59021-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2OS/c1-7(11)12-5-2-8-6-9-3-4-10-8/h3-4,6H,2,5H2,1H3
