59128-09-5 Usage
General Description
(7-Methyl-imidazo[1,2-a]pyridin-2-yl)-acetic acid is a chemical compound with potential pharmaceutical applications. It belongs to the class of imidazo[1,2-a]pyridine derivatives, which are known for their biological activities and are commonly used as building blocks in drug discovery and development. This specific compound may have potential as a therapeutic agent due to its interaction with biological targets and pathways. Its chemical structure and properties make it a valuable candidate for further research and potential drug development in the field of medicinal chemistry and pharmaceutical science.
Check Digit Verification of cas no
The CAS Registry Mumber 59128-09-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,2 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59128-09:
(7*5)+(6*9)+(5*1)+(4*2)+(3*8)+(2*0)+(1*9)=135
135 % 10 = 5
So 59128-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2/c1-7-2-3-12-6-8(5-10(13)14)11-9(12)4-7/h2-4,6H,5H2,1H3,(H,13,14)